| Primary information |
|---|
| ID | 20161 |
| Pubchem ID | 114852 |
| Name | 16-hydroxyestrone |
| Description | has implications in estrogen physiology and pathophysiology; RN given refers to parent cpd; structure in Negwer; 5th ed; #3670 |
| Synonym | 16-Hydroxyestrone 16beta-Hydroxyestrone 16alpha-Hydroxyestrone 3;16-Dihydroxyestra-1;3;5(10)-trien-17-one Estra-1;3;5(10)-trien-17-one; 3;16-dihydroxy- |
| Molecular Weight | 286.37 |
| Formula | C18H22O3 |
| IUPAC | (8R;9S;13S;14S)-3;16-dihydroxy-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILE | CC12CCC3C(C1CC(C2=O)O)CCC4=C3C=CC(=C4)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000313 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|