| Primary information |
|---|
| ID | 20150 |
| Pubchem ID | NA |
| Name | 7a;12a-Dihydroxy-cholestene-3-one |
| Description | 7a;12a-Dihydroxy-cholestene-3-one is an intermediate in bile acid synthesis; is considerably higher in patients with cerebrotendinous xanthomatosis (CTX) than in the normal liver. (PMID 7017048) |
| Synonym | 7-alpha;12-alpha-dihydroxy-4-cholesten-3-one#7-alpha;12-alpha-dihydroxycholest-4-en-3-one#7-a;12-a-dihydroxy-4-cholesten-3-one#7-a;12-a-dihydroxycholest-4-en-3-one#7alpha;12alpha-Dihydroxy-cholestene- |
| Molecular Weight | 416.64 |
| Formula | C27H44O3 |
| IUPAC | NA |
| SMILE | CC(C)CCCC(C)C1CCC2C3C(O)CC4CC(=O)C=CC4(C)C3CC(O)C12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002197 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|