| Primary information |
|---|
| ID | 20142 |
| Pubchem ID | NA |
| Name | Taurallocholic acid |
| Description | An ethanesulfonic acid derivative of Cholane. Tauroallocholic acid is a bile acid. Bile acids are steroid acids found predominantly in bile of mammals. The distinction between different bile acids is minute; depends only on presence or absence of hydroxyl groups on positions 3; 7; and 12. |
| Synonym | Taurallocholate#Taurallocholic acid |
| Molecular Weight | 515.7 |
| Formula | C26H45NO7S |
| IUPAC | 2-[[(3a;5a;7a;12a)-3;7;12-trihydroxy-24-oxocholan-24-yl]amino]-Ethanesulfonic acid |
| SMILE | CC(CCC(=O)NCCS(O)(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000922 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|