| Primary information |
|---|
| ID | 20134 |
| Pubchem ID | NA |
| Name | 5-Androstene-3b;16a;17a-triol |
| Description | 5-Androstene-3b;16a;17a-triol is a normal urinary steroid in newborn infants (PMID 14709852); in the mono- and disulfate fractions of human bile (PMID 5410667); and was found in the blood of a patient with paraquat poisoning (PMID 7094338) |
| Synonym | Androst-5-ene-3b;16a;17a-triol |
| Molecular Weight | 306.44 |
| Formula | C19H30O3 |
| IUPAC | (3b;16a;17a)-androst-5-ene-3;16;17-triol |
| SMILE | CC12CCC3C(CC=C4CC(O)CCC34C)C1CC(O)C2O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000540 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|