| Primary information |
|---|
| ID | 20132 |
| Pubchem ID | NA |
| Name | 6-Ketoestriol |
| Description | 6-Ketoestriol is a normal human metabolite that is in elevated concentration in the urine of patients with prolactinoma. (PMID 9812172) |
| Synonym | (16a;17b)-3;16;17-trihydroxy-Estra-1;3;5(10)-trien-6-one#6-Ketoestriol#6-Oxo-16a;17b-estriol#6-Oxoestratriol#6-Oxoestriol |
| Molecular Weight | 302.36 |
| Formula | C18H22O4 |
| IUPAC | (16a;17b) 3;16;17-trihydroxy-Estra-1;3;5(10)-trien-6-one |
| SMILE | CC12CCC3C(CC(=O)C4=C3C=CC(O)=C4)C1CC(O)C2O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000530 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|