| Primary information |
|---|
| ID | 20130 |
| Pubchem ID | NA |
| Name | 5a-Cholestane-3a;7a;12a;25-tetrol |
| Description | 5a-Cholestane-3a;7a;12a;25-tetrol is a bile alcohols which is excreted mainly as glucurono-conjugates in bile and urine; and as unconjugated form in feces of patients with cerebrotendinous xanthomatosis (PMID 3700361) |
| Synonym | 5a-Cholestane-3a;7a;12a;25-tetrol |
| Molecular Weight | 436.67 |
| Formula | C27H48O4 |
| IUPAC | (3a;5a;7a;12a)-Cholestane-3;7;12;25-tetrol |
| SMILE | CC(CCCC(C)(C)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000520 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|