| Primary information |
|---|
| ID | 20125 |
| Pubchem ID | NA |
| Name | 3a;16b-Dihydroxyandrostenone |
| Description | 3a;16b-Dihydroxyandrostenone is an unusual steroid found in the urinary excretion of a subject having a virilizing malignant adrenocortical tumor; apparent 21-steroid hydroxylase deficiency is discussed at the light of these results and of the hormonogenesis enzymatic induction of the tumour biopsy. |
| Synonym | 3a;16b-Dihydroxyandrostenone |
| Molecular Weight | 304.42 |
| Formula | C19H28O3 |
| IUPAC | (3a;16b)-3;16-dihydroxy-Androst-5-en-17-one |
| SMILE | CC12CCC3C(CCC4CC(O)=CC(=O)C34C)C1CC(O)C2 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000309 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|