| Primary information |
|---|
| ID | 20123 |
| Pubchem ID | 6433708 |
| Name | Zearalenone |
| Description | (S-(E))-3;4;5;6;8;10-Hexahydro-14;16-dihydroxy-3-methyl-1H-2-benzoxacy clotetradecin-1;7(8H)-dione. One of a group of compounds known under the general designation of resorcylic acid lactones. Cis; trans; dextro and levo forms have been isolated from the fungus Gibberella zeae (formerly Fusarium |
| Synonym | Zenone trans-Zearalenone Mycotoxin F2 (S)-Zearalenone F-2 toxin Zearalenone (-)-Zearalenone Compound F-2 F2 Toxin Toxin F2 |
| Molecular Weight | 318.36 |
| Formula | C18H22O5 |
| IUPAC | (4S;12E)-15;17-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14);12;15;17-tetraene-2;8-dione |
| SMILE | CC1CCCC(=O)CCCC=CC2=C(C=C(C=C2C(=O)O1)O)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | 164.5 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9YHT3; P49884; P06212; Q91424; P57717; Q53AD2; Q9TV98; P03372; Q9YHZ7; P49886; Q9QZJ5; P57753; P19785; P16058; P50240; Q9YH33; P50241; O42132; Q29040 |
| Reference | Pubchem
|