| Primary information |
|---|
| ID | 20120 |
| Pubchem ID | 6436 |
| Name | Triamcinolone Acetonide |
| Description | An esterified form of TRIAMCINOLONE. It is an anti-inflammatory glucocorticoid used topically in the treatment of various skin disorders. Intralesional; intramuscular; and intra-articular injections are also administered under certain conditions. |
| Synonym | Kenalog Triamcinolone Acetonide Polcortolon Aristoderm Aristogel Triaceton Tricinolon Azmacort Triamcinolone Acetonide Kenalone Nasacort Solodelf |
| Molecular Weight | 434.5 |
| Formula | C24H31FO6 |
| IUPAC | NA |
| SMILE | CC1(OC2CC3C4CCC5=CC(=O)C=CC5(C4(C(CC3(C2(O1)C(=O)CO)C)O)F)C)C |
| PDB ID | NA |
| KEGG | C08183; D00983 |
| HMDB ID | NA |
| Melting Point (Degree C) | 293 |
| Water Solubility | 21mg/ml at 28C |
| Drugbank ID | NA |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|