| Primary information |
|---|
| ID | 20119 |
| Pubchem ID | 31307 |
| Name | Triamcinolone |
| Description | A glucocorticoid given; as the free alcohol or in esterified form; orally; intramuscularly; by local injection; by inhalation; or applied topically in the management of various disorders in which corticosteroids are indicated. (From Martindale; The Extra Pharmacopoeia; 30th ed; p739) |
| Synonym | Triamcinolone Kenacort Fluoxyprednisolone Triamcinolon Aristocort Delphicort Rodinolone Tricortale Ledercort Adcortyl |
| Molecular Weight | 394.43 |
| Formula | C21H27FO6 |
| IUPAC | (8S;9R;10S;11S;13S;14S;16R;17S)-9-fluoro-11;16;17-trihydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC12CC(C3(C(C1CC(C2(C(=O)CO)O)O)CCC4=CC(=O)C=CC43C)F)O |
| PDB ID | NA |
| KEGG | D00385 |
| HMDB ID | NA |
| Melting Point (Degree C) | 270 |
| Water Solubility | 80mg/ml at 25C |
| Drugbank ID | DB00620 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|