| Primary information |
|---|
| ID | 20116 |
| Pubchem ID | 5819 |
| Name | L-thyroxine |
| Description | The major hormone derived from the thyroid gland. Thyroxine is synthesized via the iodination of tyrosines (MONOIODOTYROSINE) and the coupling of iodotyrosines (DIIODOTYROSINE) in the THYROGLOBULIN. Thyroxine is released from thyroglobulin by proteolysis and secreted into the blood. Thyroxine is |
| Synonym | L-thyroxine Thyroxine levothyroxine synthroid thyroxin Thyroxine iodine Levothyroxin Thyreoideum Thyratabs Thyroxinal |
| Molecular Weight | 776.87 |
| Formula | C15H11I4NO4 |
| IUPAC | (2S)-2-amino-3-[4-(4-hydroxy-3;5-diiodophenoxy)-3;5-diiodophenyl]propanoicacid |
| SMILE | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)O)N |
| PDB ID | 1ICT;1IE4;1HK1;1HK2;1HK3;1HK4;1HK5;1SN0;1Y0X;2CEO;2ROX;2RIW;1ETA;1ETB |
| KEGG | C01829 |
| HMDB ID | HMDB0000248 |
| Melting Point (Degree C) | 235.5 |
| Water Solubility | 1.05E-04mg/ml at 25C |
| Drugbank ID | DB00451 |
| Receptor | P10828; P10827 |
| Reference | Pubchem
|