| Primary information |
|---|
| ID | 20111 |
| Pubchem ID | 65373 |
| Name | Secoisolariciresinol |
| Description | RN given refers to ((R-(R*;R*))-isomer); RN for cpd without isomeric designation not available 8/89; precursor of lignans found in human urine; structure given in first source |
| Synonym | Secoisolariciresinol (-)-Secoisolariciresinol |
| Molecular Weight | 362.42 |
| Formula | C20H26O6 |
| IUPAC | (2R;3R)-2;3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1;4-diol |
| SMILE | COC1=C(C=CC(=C1)CC(CO)C(CC2=CC(=C(C=C2)O)OC)CO)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|