| Primary information |
|---|
| ID | 20110 |
| Pubchem ID | 22069 |
| Name | Reverse T3 |
| Description | A metabolite of THYROXINE; formed by the peripheral enzymatic monodeiodination of T4 at the 5 position of the inner ring of the iodothyronine nucleus. |
| Synonym | Reverse T3 Triiodothyronine; reverse Triiodothyronine; Reverse 3;3';5'-Triiodothyronine Triiodothyronine; Reverse REVERSE TRIIODOTHYRONINE Triiodothyronine; Reverse 3;3';5'-Triiodo-L-thyronine T0 |
| Molecular Weight | 650.97 |
| Formula | C15H12I3NO4 |
| IUPAC | 2-amino-3-[4-(4-hydroxy-3;5-diiodophenoxy)-3-iodophenyl]propanoic acid |
| SMILE | C1=CC(=C(C=C1CC(C(=O)O)N)I)OC2=CC(=C(C(=C2)I)O)I |
| PDB ID | NA |
| KEGG | C07639 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|