| Primary information |
|---|
| ID | 20109 |
| Pubchem ID | 9046 |
| Name | Quinestrol |
| Description | The 3-cyclopentyl ether of ETHINYL ESTRADIOL. After gastrointestinal absorption; it is stored in ADIPOSE TISSUE; slowly released; and metabolized principally to the parent compound. It has been used in ESTROGEN REPLACEMENT THERAPY. (From AMA Drug Evaluations Annual; 1992; p1011) |
| Synonym | Quinestrol Estrovis Estrovister Plestrovis Eston Qui-Lea Quinestrolo |
| Molecular Weight | 364.52 |
| Formula | C25H32O2 |
| IUPAC | (8R;9S;13S;14S;17R)-3-cyclopentyloxy-17-ethynyl-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILE | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)OC5CCCC5 |
| PDB ID | NA |
| KEGG | C07619; D00576 |
| HMDB ID | NA |
| Melting Point (Degree C) | 107.5 |
| Water Solubility | NA |
| Drugbank ID | DB04575 |
| Receptor | P03372 |
| Reference | Pubchem
|