Primary information |
---|
ID | 20108 |
Pubchem ID | 5994 |
Name | Progestrone |
Description | The major progestational steroid that is secreted primarily by the CORPUS LUTEUM and the PLACENTA. Progesterone acts on the UTERUS; the MAMMARY GLANDS and the BRAIN. It is required in EMBRYO IMPLANTATION; PREGNANCY maintenance; and the development of mammary tissue for MILK production. Progester |
Synonym | Progesterone Crinone Luteohormone Progesteronum Syngesterone Prometrium Utrogestan Cyclogest Progestin Agolutin |
Molecular Weight | 314.46 |
Formula | C21H30O2 |
IUPAC | (8S;9S;10R;13S;14S;17S)-17-acetyl-10;13-dimethyl-1;2;6;7;8;9;11;12;14;15;16;17-dodecahydrocyclopenta[a]phenanthren-3-one |
SMILE | CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |
PDB ID | 1W0F;1YA3;2AA5;2AA6;2ABA;2HZQ;2O5Y;1DBB;1A28 |
KEGG | C00410; D00066 |
HMDB ID | HMDB0001830 |
Melting Point (Degree C) | 121 |
Water Solubility | 8.81mg/ml at 25C |
Drugbank ID | DB00396 |
Receptor | P03372; P06401 |
Reference | Pubchem; HMDB
|