| Primary information |
|---|
| ID | 20107 |
| Pubchem ID | 8955 |
| Name | Pregnenolone |
| Description | A 21-carbon steroid; derived from CHOLESTEROL and found in steroid hormone-producing tissues. Pregnenolone is the precursor to GONADAL STEROID HORMONES and the adrenal CORTICOSTEROIDS. |
| Synonym | Pregnenolone Arthenolone Skinostelon Pregnetan Pregneton Pregnolon Regnosone Prenolon Enelone |
| Molecular Weight | 316.48 |
| Formula | C21H32O2 |
| IUPAC | 1-[(3S;8S;9S;10R;13S;14S;17S)-3-hydroxy-10;13-dimethyl-2;3;4;7;8;9;11;12;14;15;16;17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILE | CC(=O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| PDB ID | NA |
| KEGG | C01953; D00143 |
| HMDB ID | NA |
| Melting Point (Degree C) | 192 |
| Water Solubility | 7.06mg/ml at 37C |
| Drugbank ID | DB02789 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; O75469; Q8SQ01 |
| Reference | Pubchem
|