| Primary information |
|---|
| ID | 20106 |
| Pubchem ID | 101967 |
| Name | Pregnanetriol |
| Description | A metabolite of 17-ALPHA-HYDROXYPROTESTERONE; normally produced in small quantities by the GONADS and the ADRENAL GLANDS; found in URINE. An elevated urinary pregnanetriol is associated with CONGENITAL ADRENAL HYPERPLASIA with a deficiency of STEROID 21-HYDROXYLASE. |
| Synonym | Pregnanetriol 5Beta-pregnane-3alpha;17alpha;20alpha-triol 3alpha;17alpha;20alpha-Trihydroxy-5beta-pregnane |
| Molecular Weight | 336.51 |
| Formula | C21H36O3 |
| IUPAC | (3R;5R;8R;9S;10S;13S;14S;17R)-17-(1-hydroxyethyl)-10;13-dimethyl-1;2;3;4;5;6;7;8;9;11;12;14;15;16-tetradecahydrocyclopenta[a]phenanthrene-3;17-diol |
| SMILE | CC(C1(CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C)O)O |
| PDB ID | NA |
| KEGG | C14680 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|