| Primary information |
|---|
| ID | 20105 |
| Pubchem ID | 3032822 |
| Name | Pregnanediol |
| Description | An inactive metabolite of PROGESTERONE by reduction at C5; C3; and C20 position. Pregnanediol has two hydroxyl groups; at 3-alpha and 20-alpha. It is detectable in URINE after OVULATION and is found in great quantities in the pregnancy urine. |
| Synonym | Pregnanediol |
| Molecular Weight | 320.51 |
| Formula | C21H36O2 |
| IUPAC | (8S;9S;10S;13R;14S;17S)-17-ethyl-10;13-dimethyl-1;2;4;5;6;7;8;9;11;12;14;15;16;17-tetradecahydrocyclopenta[a]phenanthrene-3;3-diol |
| SMILE | CCC1CCC2C1(CCC3C2CCC4C3(CCC(C4)(O)O)C)C |
| PDB ID | NA |
| KEGG | C05484; D00189 |
| HMDB ID | HMDB0004025 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | A3F8U8; Q9GYU4; Q9ARY7; A6H6R7; Q0VEX8; Q14AH9; Q53WT3; Q543Z0; Q544F7; Q544G1; Q5SUU4; Q5SUU5; Q8BHM6; Q8C446; Q8C7N0; Q8CAB3; Q9JLE7; Q9JLE8; Q9JLE9 |
| Reference | HMDB
|