| Primary information |
|---|
| ID | 20104 |
| Pubchem ID | 5865 |
| Name | Prednisone |
| Description | A synthetic anti-inflammatory glucocorticoid derived from CORTISONE. It is biologically inert and converted to PREDNISOLONE in the liver. |
| Synonym | Prednisone Dehydrocortisone Deltacortisone Decortancyl Deltacortone Hostacortin Prednilonga Supercortil Ultracorten Ultracortene |
| Molecular Weight | 358.43 |
| Formula | C21H26O5 |
| IUPAC | (8S;9S;10R;13S;14S;17R)-17-hydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-6;7;8;9;12;14;15;16-octahydrocyclopenta[a]phenanthrene-3;11-dione |
| SMILE | CC12CC(=O)C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C |
| PDB ID | NA |
| KEGG | C07370 |
| HMDB ID | NA |
| Melting Point (Degree C) | 234 |
| Water Solubility | 312mg/ml at 25C |
| Drugbank ID | DB00635 |
| Receptor | P04150 |
| Reference | Pubchem
|