| Primary information |
|---|
| ID | 20103 |
| Pubchem ID | 5755 |
| Name | Prednisolone |
| Description | A glucocorticoid with the general properties of the corticosteroids. It is the drug of choice for all conditions in which routine systemic corticosteroid therapy is indicated; except adrenal deficiency states. |
| Synonym | Prednisolone Deltacortril Cortalone Delta-Cortef Deltacortenol Hydrodeltalone Hydrodeltisone Metacortandralone Meticortelone Codelcortone |
| Molecular Weight | 360.44 |
| Formula | C21H28O5 |
| IUPAC | (8S;9S;10R;11S;13S;14S;17R)-11;17-dihydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC12CC(C3C(C1CCC2(C(=O)CO)O)CCC4=CC(=O)C=CC34C)O |
| PDB ID | NA |
| KEGG | C07369; D00472 |
| HMDB ID | NA |
| Melting Point (Degree C) | 235 |
| Water Solubility | 223mg/ml at 25C |
| Drugbank ID | DB00860 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|