| Primary information |
|---|
| ID | 20100 |
| Pubchem ID | 5875 |
| Name | Paramethasone |
| Description | A glucocorticoid with the general properties of corticosteroids. It has been used by mouth in the treatment of all conditions in which corticosteroid therapy is indicated except adrenal-deficiency states for which its lack of sodium-retaining properties makes it less suitable than HYDROCORTISONE |
| Synonym | Paramethasone Flumethone Paramezone Cassenne Cortiden Alondra Metilar Dillar Parametasona |
| Molecular Weight | 392.46 |
| Formula | C22H29FO5 |
| IUPAC | (6S;8S;9S;10R;11S;13S;14S;16R;17R)-6-fluoro-11;17-dihydroxy-17-(2-hydroxyacetyl)-10;13;16-trimethyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC1CC2C3CC(C4=CC(=O)C=CC4(C3C(CC2(C1(C(=O)CO)O)C)O)C)F |
| PDB ID | NA |
| KEGG | C07413; D07464 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB01384 |
| Receptor | NA |
| Reference | Pubchem
|