| Primary information |
|---|
| ID | 20097 |
| Pubchem ID | 5858 |
| Name | Norethandrolone |
| Description | A synthetic hormone with anabolic and androgenic properties and moderate progestational activity. |
| Synonym | Pronabol Nilevar Solevar Nileva Ethylestrenolone Ethylnortestosteron Ethylnortestosterone Noretandrolone 19-Norethyltestosterone |
| Molecular Weight | 302.45 |
| Formula | C20H30O2 |
| IUPAC | (8R;9S;10R;13S;14S;17S)-17-ethyl-17-hydroxy-13-methyl-1;2;6;7;8;9;10;11;12;14;15;16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CCC1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34)C)O |
| PDB ID | NA |
| KEGG | D07127 |
| HMDB ID | NA |
| Melting Point (Degree C) | 140.5 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|