| Primary information |
|---|
| ID | 20096 |
| Pubchem ID | 9677 |
| Name | Nandrolone decanoate |
| Description | structure; used in the treatment of HIV wasting disease |
| Synonym | Retabolil nandrolone decanoate Deca-Durabolin naboline Deca-Hybolin Decadurabolin nandrolone decanoate Decadurobolin nandrolone decanoate Adenocorin Salistoperm Superbolan Anabolin |
| Molecular Weight | 428.65 |
| Formula | C28H44O3 |
| IUPAC | [(8R;9S;10R;13S;14S;17S)-13-methyl-3-oxo-2;6;7;8;9;10;11;12;14;15;16;17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]decanoate |
| SMILE | CCCCCCCCCC(=O)OC1CCC2C1(CCC3C2CCC4=CC(=O)CCC34)C |
| PDB ID | NA |
| KEGG | C08154; D00955 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|