| Primary information |
|---|
| ID | 20093 |
| Pubchem ID | 23680530 |
| Name | Methylprednisolone sodium succinate |
| Description | A water-soluble ester of METHYLPREDNISOLONE used for cardiac; allergic; and hypoxic emergencies. |
| Synonym | A-Methapred Methylprednisolone Hemisuccinate Solu-Medrol Asmacortone Metypresol Corticel Emmetipi Metypred Prednilem Firmacort Fiale Nirypan solubile |
| Molecular Weight | 496.53 |
| Formula | C26H33NaO8 |
| IUPAC | sodium4-[2-[(6S;8S;9S;10R;11S;13S;14S;17R)-11;17-dihydroxy-6;10;13-trimethyl-3-oxo-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoate |
| SMILE | CC1CC2C3CCC(C3(CC(C2C4(C1=CC(=O)C=C4)C)O)C)(C(=O)COC(=O)CCC(=O)[O-])O.[Na+] |
| PDB ID | NA |
| KEGG | D00751 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB00959 |
| Receptor | P04150 |
| Reference | Pubchem
|