| Primary information |
|---|
| ID | 20090 |
| Pubchem ID | 5366546 |
| Name | Methoprene |
| Description | Juvenile hormone analog and insect growth regulator used to control insects by disrupting metamorphosis. Has been effective in controlling mosquito larvae. |
| Synonym | Methoprene Juvemon Pharoid Yuvemon Diacon Dianex Precor Kabat Manta Minex |
| Molecular Weight | 310.47 |
| Formula | C19H34O3 |
| IUPAC | propan-2-yl (2E;4E)-11-methoxy-3;7;11-trimethyldodeca-2;4-dienoate |
| SMILE | CC(C)OC(=O)C=C(C)C=CCC(C)CCCC(C)(C)OC |
| PDB ID | NA |
| KEGG | C14308 |
| HMDB ID | NA |
| Melting Point (Degree C) | 25 |
| Water Solubility | 1.4mg/ml |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|