| Primary information |
|---|
| ID | 20089 |
| Pubchem ID | 6300 |
| Name | Methandrostenolone |
| Description | A synthetic steroid with anabolic properties that are more pronounced than its androgenic effects. It has little progestational activity. (From Martindale; The Extra Pharmacopoeia; 30th ed; p1188) |
| Synonym | Dianabol Methandrostenolone Metandienone Metandienonum Methandrolone Metandienon Nerobolettes Andoredan Dianabole Metanabol |
| Molecular Weight | 300.44 |
| Formula | C20H28O2 |
| IUPAC | (8R;9S;10R;13S;14S;17S)-17-hydroxy-10;13;17-trimethyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC3C(C1CCC2(C)O)CCC4=CC(=O)C=CC34C |
| PDB ID | NA |
| KEGG | D00389 |
| HMDB ID | NA |
| Melting Point (Degree C) | 166 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P15207 |
| Reference | Pubchem
|