| Primary information |
|---|
| ID | 20087 |
| Pubchem ID | 6291 |
| Name | Mestranol |
| Description | The 3-methyl ether of ETHINYL ESTRADIOL. It must be demethylated to be biologically active. It is used as the estrogen component of many combination ORAL CONTRACEPTIVES. |
| Synonym | Mestranol Inostral Devocin Norquen Ovastol Menophase Norinyl Norinyl Enovid Ovulen Ortho-novum Norinyl |
| Molecular Weight | 310.43 |
| Formula | C21H26O2 |
| IUPAC | (8R;9S;13S;14S;17R)-17-ethynyl-3-methoxy-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILE | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)OC |
| PDB ID | NA |
| KEGG | C07618; D00575 |
| HMDB ID | NA |
| Melting Point (Degree C) | 150.5 |
| Water Solubility | NA |
| Drugbank ID | DB01357 |
| Receptor | P03372 |
| Reference | Pubchem
|