| Primary information |
|---|
| ID | 20083 |
| Pubchem ID | 896 |
| Name | Melatonin |
| Description | A biogenic amine that is found in animals and plants. In mammals; melatonin is produced by the PINEAL GLAND. Its secretion increases in darkness and decreases during exposure to light. Melatonin is implicated in the regulation of SLEEP; mood; and REPRODUCTION. Melatonin is also an effective anti |
| Synonym | Melatonin Melatonine Circadin N-Acetyl-5-methoxytryptamine Melapure Melovine Posidorm Melatol Regulin 5-Methoxy-N-acetyltryptamine |
| Molecular Weight | 232.28 |
| Formula | C13H16N2O2 |
| IUPAC | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILE | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
| PDB ID | 2QWX;2QX4;2QX6 |
| KEGG | C01598 |
| HMDB ID | HMDB0001389 |
| Melting Point (Degree C) | 117 |
| Water Solubility | NA |
| Drugbank ID | DB01065 |
| Receptor | P03372; P48039 |
| Reference | Pubchem
|