Primary information |
---|
ID | 20083 |
Pubchem ID | 896 |
Name | Melatonin |
Description | A biogenic amine that is found in animals and plants. In mammals; melatonin is produced by the PINEAL GLAND. Its secretion increases in darkness and decreases during exposure to light. Melatonin is implicated in the regulation of SLEEP; mood; and REPRODUCTION. Melatonin is also an effective anti |
Synonym | Melatonin Melatonine Circadin N-Acetyl-5-methoxytryptamine Melapure Melovine Posidorm Melatol Regulin 5-Methoxy-N-acetyltryptamine |
Molecular Weight | 232.28 |
Formula | C13H16N2O2 |
IUPAC | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
SMILE | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
PDB ID | 2QWX;2QX4;2QX6 |
KEGG | C01598 |
HMDB ID | HMDB0001389 |
Melting Point (Degree C) | 117 |
Water Solubility | NA |
Drugbank ID | DB01065 |
Receptor | P03372; P48039 |
Reference | Pubchem
|