| Primary information |
|---|
| ID | 20082 |
| Pubchem ID | 5920 |
| Name | Triiodothyronine |
| Description | A T3 thyroid hormone normally synthesized and secreted by the thyroid gland in much smaller quantities than thyroxine (T4). Most T3 is derived from peripheral monodeiodination of T4 at the 5' position of the outer ring of the iodothyronine nucleus. The hormone finally delivered and used by the t |
| Synonym | liothyronine Triiodothyronine Liothyronin L-Liothyronine triothyrone Lyothyronine Tresitope Tri-Thyrotope T3 liothyronine Triiodo-L-thyronine |
| Molecular Weight | 650.97 |
| Formula | C15H12I3NO4 |
| IUPAC | (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3;5-diiodophenyl]propanoicacid |
| SMILE | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(C(=O)O)N)I)I)O |
| PDB ID | 1BSX;1SN5;1XZX;2H6W;2H77;2H79;2PIV;2PIW |
| KEGG | C02465 |
| HMDB ID | HMDB0000265 |
| Melting Point (Degree C) | 236.5 |
| Water Solubility | 3.96mg/ml at 37C |
| Drugbank ID | DB00279 |
| Receptor | P10827; P10828; P37243 |
| Reference | Pubchem
|