| Primary information |
|---|
| ID | 20081 |
| Pubchem ID | 5754 |
| Name | Hydrocortisone |
| Description | The main glucocorticoid secreted by the ADRENAL CORTEX. Its synthetic counterpart is used; either as an injection or topically; in the treatment of inflammation; allergy; collagen diseases; asthma; adrenocortical deficiency; shock; and some neoplastic conditions. |
| Synonym | Hydrocortisone Cortisol Cortef Acticort Cetacort Hytone Dihydrocostisone Hydrocortisyl Hydrocortone Corticreme |
| Molecular Weight | 362.46 |
| Formula | C21H30O5 |
| IUPAC | (8S;9S;10R;11S;13S;14S;17R)-11;17-dihydroxy-17-(2-hydroxyacetyl)-10;13-dimethyl-2;6;7;8;9;11;12;14;15;16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4(C(=O)CO)O)C)O |
| PDB ID | 2Q1V;2V95;2VDY |
| KEGG | C00735; D00088 |
| HMDB ID | HMDB0000063 |
| Melting Point (Degree C) | 220 |
| Water Solubility | 320mg/ml at 25C |
| Drugbank ID | DB00741 |
| Receptor | P04150 |
| Reference | Pubchem; HMDB
|