| Primary information |
|---|
| ID | 20078 |
| Pubchem ID | 27812 |
| Name | Gestrinone |
| Description | A non-estrogenic contraceptive which is a weak progestin with strong anti-progesterone properties. It is effective if used once a week orally or can also be used in intravaginal devices. |
| Synonym | Gestrinone Dimetriose Nemestran Tridomose Ethylnorgestrienone Gestrinonum Ambap4002 Gestrinona |
| Molecular Weight | 308.41 |
| Formula | C21H24O2 |
| IUPAC | (8S;13S;14S;17R)-13-ethyl-17-ethynyl-17-hydroxy-1;2;6;7;8;14;15;16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CCC12C=CC3=C4CCC(=O)C=C4CCC3C1CCC2(C#C)O |
| PDB ID | NA |
| KEGG | D04317 |
| HMDB ID | HMDB0002720 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem; HMDB
|