| Primary information |
|---|
| ID | 20076 |
| Pubchem ID | 5280961 |
| Name | Genistein |
| Description | An isoflavonoid derived from soy products. It inhibits PROTEIN-TYROSINE KINASE and topoisomerase-II (DNA TOPOISOMERASES; TYPE II); activity and is used as an antineoplastic and antitumor agent. Experimentally; it has been shown to induce G2 PHASE arrest in human and murine cell lines and inhibit |
| Synonym | Genistein Genisteol Genisterin Prunetol Sophoricol Genestein Genistein Differenol A Bonistein 4';5;7-Trihydroxyisoflavone Lactoferrin-genistein |
| Molecular Weight | 270.24 |
| Formula | C15H10O5 |
| IUPAC | 5;7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILE | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| PDB ID | NA |
| KEGG | C06563 |
| HMDB ID | HMDB0003217 |
| Melting Point (Degree C) | 301.5 |
| Water Solubility | NA |
| Drugbank ID | DB01645 |
| Receptor | Q92731 |
| Reference | Pubchem
|