Primary information |
---|
ID | 20075 |
Pubchem ID | 5280378 |
Name | Formononetin |
Description | intermediate to formation of ROTENONE; has a deleterious effect on sheep grazing in "estrogenic clover" pastures; RN given refers to unlabeled cpd |
Synonym | formononetin Biochanin B Formononetol 7-Hydroxy-4'-methoxyisoflavone |
Molecular Weight | 268.26 |
Formula | C16H12O4 |
IUPAC | 7-hydroxy-3-(4-methoxyphenyl)chromen-4-one |
SMILE | COC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O |
PDB ID | NA |
KEGG | C00858 |
HMDB ID | HMDB0005808 |
Melting Point (Degree C) | 256.5 |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | P62510; Q9YHT3; P49884; P06212; Q91424; P57717; Q53AD2; Q9TV98; P03372; Q9YHZ7; P49886; Q9QZJ5; P57753; P19785; P16058; P50240; Q9YH33; P50241; O42132 |
Reference | Pubchem
|