| Primary information |
|---|
| ID | 20074 |
| Pubchem ID | 15209 |
| Name | Flurandrenolone |
| Description | A corticosteroid used topically in the treatment of various skin disorders. It is usually employed as a cream or an ointment; and is also used as a polyethylene tape with an adhesive. (From Martindale; The Extra Pharmacopoeia; 30th ed; p733) |
| Synonym | Flurandrenolone Fludroxycortide Cordran Fludroxicortidum Drenison Drocort Sermaka Haelan |
| Molecular Weight | 436.51 |
| Formula | C24H33FO6 |
| IUPAC | NA |
| SMILE | CC1(OC2CC3C4CC(C5=CC(=O)CCC5(C4C(CC3(C2(O1)C(=O)CO)C)O)C)F)C |
| PDB ID | NA |
| KEGG | D00328 |
| HMDB ID | NA |
| Melting Point (Degree C) | 251 |
| Water Solubility | NA |
| Drugbank ID | DB00846 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|