| Primary information |
|---|
| ID | 20072 |
| Pubchem ID | 6446 |
| Name | Fluoxymesterone |
| Description | An anabolic steroid that has been used in the treatment of male HYPOGONADISM; delayed puberty in males; and in the treatment of breast neoplasms in women. |
| Synonym | Fluoxymesterone Androfluorene Androfluorone Halotestin Androsterolo Fluosterone Oralsterone Fluotestin |
| Molecular Weight | 336.44 |
| Formula | C20H29FO3 |
| IUPAC | (8S;9R;10S;11S;13S;14S;17S)-9-fluoro-11;17-dihydroxy-10;13;17-trimethyl-1;2;6;7;8;11;12;14;15;16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC12CCC(=O)C=C1CCC3C2(C(CC4(C3CCC4(C)O)C)O)F |
| PDB ID | NA |
| KEGG | D00327 |
| HMDB ID | NA |
| Melting Point (Degree C) | 270 |
| Water Solubility | 67.5mg/ml at 25C |
| Drugbank ID | DB01185 |
| Receptor | P03372; P10275 |
| Reference | Pubchem
|