| Primary information |
|---|
| ID | 20071 |
| Pubchem ID | 9878 |
| Name | Fluorometholone |
| Description | A glucocorticoid employed; usually as eye drops; in the treatment of allergic and inflammatory conditions of the eye. It has also been used topically in the treatment of various skin disorders. (From Martindale; The Extra Pharmacopoeia; 30th ed; p732) |
| Synonym | Fluorometholone Oxylone Flumetholon Cortilet Delmeson Trilcin FML Liquifilm Fluormetholonum |
| Molecular Weight | 376.46 |
| Formula | C22H29FO4 |
| IUPAC | (6S;8S;9R;10S;11S;13S;14S;17R)-17-acetyl-9-fluoro-11;17-dihydroxy-6;10;13-trimethyl-6;7;8;11;12;14;15;16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC1CC2C3CCC(C3(CC(C2(C4(C1=CC(=O)C=C4)C)F)O)C)(C(=O)C)O |
| PDB ID | NA |
| KEGG | D01367 |
| HMDB ID | NA |
| Melting Point (Degree C) | 297 |
| Water Solubility | 30mg/ml at 25C |
| Drugbank ID | DB00324 |
| Receptor | P59667 |
| Reference | Pubchem
|