| Primary information |
|---|
| ID | 20068 |
| Pubchem ID | 6215 |
| Name | Fluocinolone Acetonide |
| Description | A glucocorticoid derivative used topically in the treatment of various skin disorders. It is usually employed as a cream; gel; lotion; or ointment. It has also been used topically in the treatment of inflammatory eye; ear; and nose disorders. (From Martindale; The Extra Pharmacopoeia; 30th ed; p |
| Synonym | Synandone Synalar Fluocinolone Acetonide Synandrone Coriphate Fluovitif Flupollon Percutina Dermalar Flucinar Fluocinolone Acetonide |
| Molecular Weight | 452.49 |
| Formula | C24H30F2O6 |
| IUPAC | NA |
| SMILE | CC1(OC2CC3C4CC(C5=CC(=O)C=CC5(C4(C(CC3(C2(O1)C(=O)CO)C)O)F)C)F)C |
| PDB ID | NA |
| KEGG | D01825 |
| HMDB ID | NA |
| Melting Point (Degree C) | 265.5 |
| Water Solubility | 11mg/ml at 25C |
| Drugbank ID | DB00591 |
| Receptor | P79686; Q6XLJ0; P49115; P04150; P06537; P49843; O73673; Q9N1U3; Q5R9P5; P59667; P06536; P79269; O13186; O46567; P35547; Q95267; P49844; Q3MSN1; Q3MSN4 |
| Reference | Pubchem
|