| Primary information |
|---|
| ID | 20064 |
| Pubchem ID | 5991 |
| Name | Ethinyl Estradiol |
| Description | A semisynthetic alkylated ESTRADIOL with a 17-alpha-ethinyl substitution. It has high estrogenic potency when administered orally; and is often used as the estrogenic component in ORAL CONTRACEPTIVES. |
| Synonym | Ethinyl Estradiol Ethynylestradiol Estinyl Etinoestryl Etistradiol Ethinoral Eticyclin Eticyclol Etinestrol |
| Molecular Weight | 296.4 |
| Formula | C20H24O2 |
| IUPAC | (8R;9S;13S;14S;17R)-17-ethynyl-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthrene-3;17-diol |
| SMILE | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)O |
| PDB ID | NA |
| KEGG | C07534; D00554 |
| HMDB ID | NA |
| Melting Point (Degree C) | 183 |
| Water Solubility | 11.3mg/ml at 27C |
| Drugbank ID | DB00977 |
| Receptor | P03372; O75469 |
| Reference | Pubchem
|