| Primary information |
|---|
| ID | 20063 |
| Pubchem ID | 5870 |
| Name | Estrone |
| Description | An aromatized C18 steroid with a 3-hydroxyl group and a 17-ketone; a major mammalian estrogen. It is converted from ANDROSTENEDIONE directly; or from TESTOSTERONE via ESTRADIOL. In humans; it is produced primarily by the cyclic ovaries; PLACENTA; and the ADIPOSE TISSUE of men and postmenopausal |
| Synonym | Estrone folliculin Theelin Cristallovar Crinovaryl Aquacrine Crystogen Destrone estrovarin Endofolliculina |
| Molecular Weight | 270.37 |
| Formula | C18H22O2 |
| IUPAC | (8R;9S;13S;14S)-3-hydroxy-13-methyl-7;8;9;11;12;14;15;16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILE | CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)O |
| PDB ID | NA |
| KEGG | C00468; D00067 |
| HMDB ID | HMDB0000145 |
| Melting Point (Degree C) | 260.2 |
| Water Solubility | 30mg/ml at 25C |
| Drugbank ID | DB00655 |
| Receptor | P03372 |
| Reference | Pubchem
|