| Primary information |
|---|
| ID | 20062 |
| Pubchem ID | 5756 |
| Name | Estriol |
| Description | A hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3-beta; 16-alpha; and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY; large amount of estriol is produced by the PLACENTA. Isomers with inversion of the hydroxyl group or groups are called ep |
| Synonym | Estriol Oestriol Estratriol Tridestrin Ovestrion Trihydroxyestrin Aacifemine Oestratriol Oestriolum Destriol |
| Molecular Weight | 288.38 |
| Formula | C18H24O3 |
| IUPAC | (8R;9S;13S;14S;16R;17R)-13-methyl-6;7;8;9;11;12;14;15;16;17-decahydrocyclopenta[a]phenanthrene-3;16;17-triol |
| SMILE | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
| PDB ID | 1X8V |
| KEGG | C05141; D00185 |
| HMDB ID | HMDB0000153 |
| Melting Point (Degree C) | 282 |
| Water Solubility | 441mg/ml at 25C |
| Drugbank ID | DB04573 |
| Receptor | P03372 |
| Reference | Pubchem; HMDB
|