| Primary information |
|---|
| ID | 20061 |
| Pubchem ID | 5757 |
| Name | Estradiol |
| Description | Generally refers to the 17-beta-isomer of estradiol; an aromatized C18 steroid with hydroxyl group at 3-beta- and 17-beta-position. Estradiol-17-beta is the most potent form of mammalian estrogenic steroids. In humans; it is produced primarily by the cyclic ovaries and the PLACENTA. It is also p |
| Synonym | Estradiol beta-Estradiol 17beta-Estradiol Estrace progynon Dihydroxyestrin Oestradiol Diogynets Aquadiol Dihydrofolliculin |
| Molecular Weight | 272.38 |
| Formula | C18H24O2 |
| IUPAC | (8R;9S;13S;14S;17S)-13-methyl-6;7;8;9;11;12;14;15;16;17-decahydrocyclopenta[a]phenanthrene-3;17-diol |
| SMILE | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
| PDB ID | 1QKT;1QKU;1JGL;1G50;1JNN;1GWR;1LHU;1PCG;2D06;2J7X;1A52;1AQU;1IOL;1A27;1FDS;1FDT;1FDW;2OCF;1ERE |
| KEGG | C00951; D00105 |
| HMDB ID | HMDB0000151 |
| Melting Point (Degree C) | 178.5 |
| Water Solubility | 3.6mg/ml at 27C |
| Drugbank ID | DB00783 |
| Receptor | P03372; Q92731; O75469 |
| Reference | Pubchem
|