| Primary information |
|---|
| ID | 20058 |
| Pubchem ID | 3247 |
| Name | Equilin |
| Description | An estrogenic steroid produced by HORSES. It has a total of four double bonds in the A- and B-ring. High concentration of euilin is found in the URINE of pregnant mares. |
| Synonym | Equilin Dihydroequilenin 7-Dehydroestrone |
| Molecular Weight | 268.35 |
| Formula | C18H20O2 |
| IUPAC | 3-hydroxy-13-methyl-9;11;12;14;15;16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILE | CC12CCC3C(=CCC4=C3C=CC(=C4)O)C1CCC2=O |
| PDB ID | NA |
| KEGG | C14392; D04041 |
| HMDB ID | NA |
| Melting Point (Degree C) | 239 |
| Water Solubility | 1.41mg/ml at 25C |
| Drugbank ID | DB02187 |
| Receptor | P03372; Q92731; Q9H2M1; Q9H2M2 |
| Reference | Pubchem
|