| Primary information |
|---|
| ID | 20057 |
| Pubchem ID | 444865 |
| Name | Equilenin |
| Description | An estrogenic steroid produced by HORSES. It has a total of five double bonds in the A- and B-ring. High concentration of equilenin is found in the URINE of pregnant mares. |
| Synonym | Equilenin solution Ambap7299 3-Hydroxy-1;3;5(10);6;8-estrapentaen-17-one |
| Molecular Weight | 266.33 |
| Formula | C18H18O2 |
| IUPAC | (13S;14S)-3-hydroxy-13-methyl-12;14;15;16-tetrahydro-11H-cyclopenta[a]phenanthren-17-one |
| SMILE | CC12CCC3=C(C1CCC2=O)C=CC4=C3C=CC(=C4)O |
| PDB ID | 1GS3;1OGX;1CQS;1OH0;1OGZ;1OHO;1W6Y;1QJG |
| KEGG | C14303 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P03372; Q92731; Q9H2M1; Q9H2M2 |
| Reference | Pubchem
|