| Primary information |
|---|
| ID | 20053 |
| Pubchem ID | 5459840 |
| Name | Ecdysterone |
| Description | A steroid hormone that regulates the processes of MOLTING or ecdysis in insects. Ecdysterone is the 20-hydroxylated ECDYSONE. |
| Synonym | Ecdysterone beta-Ecdysone Polypodine A Crustecdysone Isoinokosterone Viticosterone Commisterone Crustecdyson Ecdysteron 20-HYDROXYECDYSONE |
| Molecular Weight | 480.63 |
| Formula | C27H44O7 |
| IUPAC | (2S;3R;5R;9R;10R;13R;14S;17S)-2;3;14-trihydroxy-10;13-dimethyl-17-[(2R;3R)-2;3;6-trihydroxy-6-methylheptan-2-yl]-2;3;4;5;9;11;12;15;16;17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILE | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O |
| PDB ID | 2R40 |
| KEGG | C02633 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P17672; P13055; P17671; O01639; P50239; Q08893; P45447; P49880; P49881; P49882; P34021; O18473; O18531; P49883 |
| Reference | Pubchem
|