| Primary information |
|---|
| ID | 20052 |
| Pubchem ID | 19212 |
| Name | alpha-Ecdysone |
| Description | A steroid hormone that regulates the processes of MOLTING or ecdysis in insects. |
| Synonym | alpha-Ecdysone Ecdysone |
| Molecular Weight | 464.63 |
| Formula | C27H44O6 |
| IUPAC | (2S;3R;5R;9R;10R;13R;14S;17R)-17-[(2S;3R)-3;6-dihydroxy-6-methylheptan-2-yl]-2;3;14-trihydroxy-10;13-dimethyl-2;3;4;5;9;11;12;15;16;17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILE | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)O)O |
| PDB ID | NA |
| KEGG | C00477 |
| HMDB ID | NA |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|