| Primary information |
|---|
| ID | 20051 |
| Pubchem ID | 9051 |
| Name | Dydrogesterone |
| Description | A synthetic progestational hormone with no androgenic or estrogenic properties. Unlike many other progestational compounds; dydrogesterone produces no increase in temperature and does not inhibit OVULATION. |
| Synonym | Dydrogesterone Hydrogesterone Isopregnenone Duphaston Gynorest Diphaston Gestatron Dufaston Duvaron |
| Molecular Weight | 312.45 |
| Formula | C21H28O2 |
| IUPAC | (8S;9R;10S;13S;14S;17S)-17-acetyl-10;13-dimethyl-1;2;8;9;11;12;14;15;16;17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILE | CC(=O)C1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34C)C |
| PDB ID | NA |
| KEGG | D01217 |
| HMDB ID | NA |
| Melting Point (Degree C) | 169.5 |
| Water Solubility | NA |
| Drugbank ID | DB00378 |
| Receptor | P06401 |
| Reference | Pubchem
|