| Primary information |
|---|
| ID | 20050 |
| Pubchem ID | 9305 |
| Name | Diiodotyrosine |
| Description | A product from the iodination of MONOIODOTYROSINE. In the biosynthesis of thyroid hormones; diiodotyrosine residues are coupled with other monoiodotyrosine or diiodotyrosine residues to form T4 or T3 thyroid hormones (THYROXINE and TRIIODOTHYRONINE). |
| Synonym | L-Diiodotyrosine 3;5-Diiodo-L-tyrosine DIT (amino acid) L-3;5-Diiodotyrosine 3;5-L-Diiodotyrosine 3;5-Iodo-L-tyrosine 3;5-DIIODOTYROSINE L-Tyrosine; 3;5-diiodo- |
| Molecular Weight | 432.98 |
| Formula | C9H9I2NO3 |
| IUPAC | (2S)-2-amino-3-(4-hydroxy-3;5-diiodophenyl)propanoic acid |
| SMILE | C1=C(C=C(C(=C1I)O)I)CC(C(=O)O)N |
| PDB ID | NA |
| KEGG | C01060Â |
| HMDB ID | HMDB0003474 |
| Melting Point (Degree C) | NA |
| Water Solubility | 617mg/ml at 25C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|