| Primary information |
|---|
| ID | 20049 |
| Pubchem ID | 37123 |
| Name | Diflubenzuron |
| Description | An insect growth regulator which interferes with the formation of the insect cuticle. It is effective in the control of mosquitoes and flies. |
| Synonym | Difluron Diflubenzuron Dimilin Duphacid Larvakil Micromite Astonex Dimilin G1 Dimilin G4 |
| Molecular Weight | 310.68 |
| Formula | C14H9ClF2N2O2 |
| IUPAC | N-[(4-chlorophenyl)carbamoyl]-2;6-difluorobenzamide |
| SMILE | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC=C(C=C2)Cl)F |
| PDB ID | NA |
| KEGG | C14427; D07829 |
| HMDB ID | NA |
| Melting Point (Degree C) | 239 |
| Water Solubility | 0.08mg/ml at 25C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|