| Primary information |
|---|
| ID | 20048 |
| Pubchem ID | 17455 |
| Name | Diflucortolone |
| Description | A topical glucocorticoid used in various DERMATOSES. It is absorbed through the skin; bound to plasma albumin; and may cause adrenal suppression. It is also administered as the valerate. |
| Synonym | Diflucortolone Diflucortolonum Diflucortolona |
| Molecular Weight | 394.45 |
| Formula | C22H28F2O4 |
| IUPAC | (6S;9R;16R)-6;9-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10;13;16-trimethyl-7;8;11;12;14;15;16;17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILE | CC1CC2C3CC(C4=CC(=O)C=CC4(C3(C(CC2(C1C(=O)CO)C)O)F)C)F |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | NA |
| Melting Point (Degree C) | 242 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | Pubchem
|