| Primary information |
|---|
| ID | 20046 |
| Pubchem ID | 448537 |
| Name | Diethylstilbestrol |
| Description | A synthetic nonsteroidal estrogen used in the treatment of menopausal and postmenopausal disorders. It was also used formerly as a growth promoter in animals. According to the Fourth Annual Report on Carcinogens (NTP 85-002; 1985); diethylstilbestrol has been listed as a known carcinogen. (Merck |
| Synonym | Diethylstilbestrol Stilbestrol Agostilben Stilbetin Vagestrol Stilboestroform Menostilbeen Oestrogenine Oestromenin Oestromensyl |
| Molecular Weight | 268.35 |
| Formula | C18H20O2 |
| IUPAC | 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol |
| SMILE | CCC(=C(CC)C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| PDB ID | NA |
| KEGG | C07620; D00577 |
| HMDB ID | NA |
| Melting Point (Degree C) | 170.5 |
| Water Solubility | 12mg/ml at 25C |
| Drugbank ID | DB00255 |
| Receptor | P03372; P62510; P62508 |
| Reference | Pubchem
|